C28H35NO3 — CID 23470423
(8-ethyl-9-hexyl-1,2,3,4-tetrahydrocarbazol-3-yl) 4-methoxybenzoate (PubChem CID 23470423) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is (8-ethyl-9-hexyl-1,2,3,4-tetrahydrocarbazol-3-yl) 4-methoxybenzoate.
| Compound Name | (8-ethyl-9-hexyl-1,2,3,4-tetrahydrocarbazol-3-yl) 4-methoxybenzoate |
|---|---|
| PubChem CID | 23470423 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | (8-ethyl-9-hexyl-1,2,3,4-tetrahydrocarbazol-3-yl) 4-methoxybenzoate |
| SMILES | CCCCCCn1c2c(c3cccc(CC)c31)CC(OC(=O)c1ccc(OC)cc1)CC2 |
| InChI | InChI=1S/C28H35NO3/c1-4-6-7-8-18-29-26-17-16-23(32-28(30)21-12-14-22(31-3)15-13-21)19-25(26)24-11-9-10-20(5-2)27(24)29/h9-15,23H,4-8,16-19H2,1-3H3 |
| InChIKey | UHAIZAPDIPEHKR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|