C26H23NO5 — CID 23471833
(E)-3-(3,4-dimethoxyphenyl)-N-(5,6-dimethyl-9-oxoxanthen-3-yl)prop-2-enamide (PubChem CID 23471833) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-(5,6-dimethyl-9-oxoxanthen-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-(5,6-dimethyl-9-oxoxanthen-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 23471833 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-(5,6-dimethyl-9-oxoxanthen-3-yl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccc3c(=O)c4ccc(C)c(C)c4oc3c2)cc1OC |
| InChI | InChI=1S/C26H23NO5/c1-15-5-9-20-25(29)19-10-8-18(14-22(19)32-26(20)16(15)2)27-24(28)12-7-17-6-11-21(30-3)23(13-17)31-4/h5-14H,1-4H3,(H,27,28)/b12-7+ |
| InChIKey | DVLQMXRAUPQTGS-KPKJPENVSA-N |
| XLogP | 5.23 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|