C23H18N4O6S — CID 23472752
6-ethoxy-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 23472752) has the molecular formula C23H18N4O6S and a molecular weight of 478.49 g/mol. Its IUPAC name is 6-ethoxy-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 6-ethoxy-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 23472752 |
| Molecular Formula | C23H18N4O6S |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 6-ethoxy-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCOc1ccc2c(=O)c3c(oc2c1)C(=O)N(c1nnc(CC)s1)C3c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H18N4O6S/c1-3-17-24-25-23(34-17)26-19(12-6-5-7-13(10-12)27(30)31)18-20(28)15-9-8-14(32-4-2)11-16(15)33-21(18)22(26)29/h5-11,19H,3-4H2,1-2H3 |
| InChIKey | JVMSQOAJOYUELR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 128.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|