C22H16N4O6S — CID 23472407
2-(5-ethyl-1,3,4-thiadiazol-2-yl)-6-methoxy-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 23472407) has the molecular formula C22H16N4O6S and a molecular weight of 464.46 g/mol. Its IUPAC name is 2-(5-ethyl-1,3,4-thiadiazol-2-yl)-6-methoxy-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(5-ethyl-1,3,4-thiadiazol-2-yl)-6-methoxy-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 23472407 |
| Molecular Formula | C22H16N4O6S |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 2-(5-ethyl-1,3,4-thiadiazol-2-yl)-6-methoxy-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCc1nnc(N2C(=O)c3oc4cc(OC)ccc4c(=O)c3C2c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C22H16N4O6S/c1-3-16-23-24-22(33-16)25-18(11-4-6-12(7-5-11)26(29)30)17-19(27)14-9-8-13(31-2)10-15(14)32-20(17)21(25)28/h4-10,18H,3H2,1-2H3 |
| InChIKey | UGUATMSLXWCRAE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 128.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|