C21H14N4O6S — CID 40817682
(1S)-6-methoxy-2-(5-methyl-1,3,4-thiadiazol-2-yl)-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 40817682) has the molecular formula C21H14N4O6S and a molecular weight of 450.43 g/mol. Its IUPAC name is (1S)-6-methoxy-2-(5-methyl-1,3,4-thiadiazol-2-yl)-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1S)-6-methoxy-2-(5-methyl-1,3,4-thiadiazol-2-yl)-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 40817682 |
| Molecular Formula | C21H14N4O6S |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | (1S)-6-methoxy-2-(5-methyl-1,3,4-thiadiazol-2-yl)-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COc1ccc2c(=O)c3c(oc2c1)C(=O)N(c1nnc(C)s1)[C@H]3c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H14N4O6S/c1-10-22-23-21(32-10)24-17(11-3-5-12(6-4-11)25(28)29)16-18(26)14-8-7-13(30-2)9-15(14)31-19(16)20(24)27/h3-9,17H,1-2H3/t17-/m0/s1 |
| InChIKey | WONIYRJWWDZCSZ-KRWDZBQOSA-N |
| XLogP | 3.62 |
| TPSA | 128.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|