C24H19N3O3 — CID 23473432
4-(3,4-dihydro-2H-quinolin-1-yl)-3-nitro-1-phenylquinolin-2-one (PubChem CID 23473432) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-quinolin-1-yl)-3-nitro-1-phenylquinolin-2-one.
| Compound Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-3-nitro-1-phenylquinolin-2-one |
|---|---|
| PubChem CID | 23473432 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-3-nitro-1-phenylquinolin-2-one |
| SMILES | O=c1c([N+](=O)[O-])c(N2CCCc3ccccc32)c2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C24H19N3O3/c28-24-23(27(29)30)22(25-16-8-10-17-9-4-6-14-20(17)25)19-13-5-7-15-21(19)26(24)18-11-2-1-3-12-18/h1-7,9,11-15H,8,10,16H2 |
| InChIKey | YKEGJZHSVNJPSR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|