C15H12Cl2N2O4S — CID 141060965
4-chloro-2-(3,4-dihydro-2H-quinolin-1-yl)-3-nitrobenzenesulfonyl chloride (PubChem CID 141060965) has the molecular formula C15H12Cl2N2O4S and a molecular weight of 387.24 g/mol. Its IUPAC name is 4-chloro-2-(3,4-dihydro-2H-quinolin-1-yl)-3-nitrobenzenesulfonyl chloride.
| Compound Name | 4-chloro-2-(3,4-dihydro-2H-quinolin-1-yl)-3-nitrobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 141060965 |
| Molecular Formula | C15H12Cl2N2O4S |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 4-chloro-2-(3,4-dihydro-2H-quinolin-1-yl)-3-nitrobenzenesulfonyl chloride |
| SMILES | O=[N+]([O-])c1c(Cl)ccc(S(=O)(=O)Cl)c1N1CCCc2ccccc21 |
| InChI | InChI=1S/C15H12Cl2N2O4S/c16-11-7-8-13(24(17,22)23)15(14(11)19(20)21)18-9-3-5-10-4-1-2-6-12(10)18/h1-2,4,6-8H,3,5,9H2 |
| InChIKey | MSVMSJARTIGCII-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|