C13H17ClN2O5S — CID 2348902
2-chloro-5-(2-morpholin-4-ium-4-ylethylsulfamoyl)benzoate (PubChem CID 2348902) has the molecular formula C13H17ClN2O5S and a molecular weight of 348.81 g/mol. Its IUPAC name is 2-chloro-5-(2-morpholin-4-ium-4-ylethylsulfamoyl)benzoate.
| Compound Name | 2-chloro-5-(2-morpholin-4-ium-4-ylethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2348902 |
| Molecular Formula | C13H17ClN2O5S |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-chloro-5-(2-morpholin-4-ium-4-ylethylsulfamoyl)benzoate |
| SMILES | O=C([O-])c1cc(S(=O)(=O)NCC[NH+]2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C13H17ClN2O5S/c14-12-2-1-10(9-11(12)13(17)18)22(19,20)15-3-4-16-5-7-21-8-6-16/h1-2,9,15H,3-8H2,(H,17,18) |
| InChIKey | YKCWURVQFMZOQQ-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |