C15H25N2O3S+ — CID 7381126
2,4,5-trimethyl-N-(2-morpholin-4-ium-4-ylethyl)benzenesulfonamide (PubChem CID 7381126) has the molecular formula C15H25N2O3S+ and a molecular weight of 313.44 g/mol. Its IUPAC name is 2,4,5-trimethyl-N-(2-morpholin-4-ium-4-ylethyl)benzenesulfonamide.
| Compound Name | 2,4,5-trimethyl-N-(2-morpholin-4-ium-4-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 7381126 |
| Molecular Formula | C15H25N2O3S+ |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 2,4,5-trimethyl-N-(2-morpholin-4-ium-4-ylethyl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCC[NH+]2CCOCC2)cc1C |
| InChI | InChI=1S/C15H24N2O3S/c1-12-10-14(3)15(11-13(12)2)21(18,19)16-4-5-17-6-8-20-9-7-17/h10-11,16H,4-9H2,1-3H3/p+1 |
| InChIKey | UJIHRNKXCWJAMW-UHFFFAOYSA-O |
| XLogP | -0.19 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |