C16H27N2O4S+ — CID 7242123
2-methoxy-N-(2-morpholin-4-ium-4-ylethyl)-5-propan-2-ylbenzenesulfonamide (PubChem CID 7242123) has the molecular formula C16H27N2O4S+ and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-methoxy-N-(2-morpholin-4-ium-4-ylethyl)-5-propan-2-ylbenzenesulfonamide.
| Compound Name | 2-methoxy-N-(2-morpholin-4-ium-4-ylethyl)-5-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 7242123 |
| Molecular Formula | C16H27N2O4S+ |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-methoxy-N-(2-morpholin-4-ium-4-ylethyl)-5-propan-2-ylbenzenesulfonamide |
| SMILES | COc1ccc(C(C)C)cc1S(=O)(=O)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C16H26N2O4S/c1-13(2)14-4-5-15(21-3)16(12-14)23(19,20)17-6-7-18-8-10-22-11-9-18/h4-5,12-13,17H,6-11H2,1-3H3/p+1 |
| InChIKey | SSEHNFZWUTWWOG-UHFFFAOYSA-O |
| XLogP | 0.01 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |