C15H18N4O3S — CID 23493167
2-[ethyl-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]amino]ethanol (PubChem CID 23493167) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-[ethyl-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[ethyl-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 23493167 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-[ethyl-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]amino]ethanol |
| SMILES | CCN(CCO)c1ncnc(Sc2ccc(C)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N4O3S/c1-3-18(8-9-20)14-13(19(21)22)15(17-10-16-14)23-12-6-4-11(2)5-7-12/h4-7,10,20H,3,8-9H2,1-2H3 |
| InChIKey | UCWXMKJTIRLSHC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 92.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|