C18H19N3O2 — CID 23497552
4,11,11-trimethyl-8-phenyl-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-6,10-dione (PubChem CID 23497552) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 4,11,11-trimethyl-8-phenyl-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-6,10-dione.
| Compound Name | 4,11,11-trimethyl-8-phenyl-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-6,10-dione |
|---|---|
| PubChem CID | 23497552 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 4,11,11-trimethyl-8-phenyl-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene-6,10-dione |
| SMILES | Cn1[nH]c(=O)c2c1NC1=C(C(=O)C(C)(C)C1)C2c1ccccc1 |
| InChI | InChI=1S/C18H19N3O2/c1-18(2)9-11-13(15(18)22)12(10-7-5-4-6-8-10)14-16(19-11)21(3)20-17(14)23/h4-8,12,19H,9H2,1-3H3,(H,20,23) |
| InChIKey | SRSFCDRSVZORGY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |