C12H22O6Si — CID 23497843
2-(1,2-dihydroxyethyl)-4-hydroxy-3-(3-trimethylsilylpropoxy)-2H-furan-5-one (PubChem CID 23497843) has the molecular formula C12H22O6Si and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-(1,2-dihydroxyethyl)-4-hydroxy-3-(3-trimethylsilylpropoxy)-2H-furan-5-one.
| Compound Name | 2-(1,2-dihydroxyethyl)-4-hydroxy-3-(3-trimethylsilylpropoxy)-2H-furan-5-one |
|---|---|
| PubChem CID | 23497843 |
| Molecular Formula | C12H22O6Si |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-(1,2-dihydroxyethyl)-4-hydroxy-3-(3-trimethylsilylpropoxy)-2H-furan-5-one |
| SMILES | C[Si](C)(C)CCCOC1=C(O)C(=O)OC1C(O)CO |
| InChI | InChI=1S/C12H22O6Si/c1-19(2,3)6-4-5-17-11-9(15)12(16)18-10(11)8(14)7-13/h8,10,13-15H,4-7H2,1-3H3 |
| InChIKey | TZFYSKMLRSXRKU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|