About [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-ethylhexanoate
[2-(4-bromophenyl)-2-oxoethyl] (2R)-2-ethylhexanoate (PubChem CID 2349838) has the molecular formula C16H21BrO3
and a molecular weight of 341.25 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-ethylhexanoate.
Molecular Properties
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-ethylhexanoate |
| PubChem CID | 2349838 |
| Molecular Formula | C16H21BrO3 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-ethylhexanoate |
| SMILES | CCCC[C@@H](CC)C(=O)OCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H21BrO3/c1-3-5-6-12(4-2)16(19)20-11-15(18)13-7-9-14(17)10-8-13/h7-10,12H,3-6,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | RPTBYIUPRYSJTQ-GFCCVEGCSA-N |
| XLogP | 4.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-ethylhexanoate?
The IUPAC name of [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-ethylhexanoate (CID 2349838) is [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-ethylhexanoate.
What is the SMILES notation for [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-ethylhexanoate?
The canonical SMILES for [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-ethylhexanoate is CCCC[C@@H](CC)C(=O)OCC(=O)c1ccc(Br)cc1.
What is the InChIKey of [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-ethylhexanoate?
The InChIKey is RPTBYIUPRYSJTQ-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H21BrO3/c1-3-5-6-12(4-2)16(19)20-11-15(18)13-7-9-14(17)10-8-13/h7-10,12H,3-6,11H2,1-2H3/t12-/m1/s1.
What are the key properties of [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-ethylhexanoate?
[2-(4-bromophenyl)-2-oxoethyl] (2R)-2-ethylhexanoate has a molecular weight of 341.25 g/mol, XLogP of 4.39, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-bromophenyl)-2-oxoethyl] (2R)-2-ethylhexanoate is sourced from PubChem (CID 2349838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).