About [2-(4-bromophenyl)-2-oxoethyl] (7S)-7-hydroxydecanoate
[2-(4-bromophenyl)-2-oxoethyl] (7S)-7-hydroxydecanoate (PubChem CID 46209633) has the molecular formula C18H25BrO4
and a molecular weight of 385.30 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] (7S)-7-hydroxydecanoate.
Molecular Properties
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] (7S)-7-hydroxydecanoate |
| PubChem CID | 46209633 |
| Molecular Formula | C18H25BrO4 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] (7S)-7-hydroxydecanoate |
| SMILES | CCC[C@H](O)CCCCCC(=O)OCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H25BrO4/c1-2-6-16(20)7-4-3-5-8-18(22)23-13-17(21)14-9-11-15(19)12-10-14/h9-12,16,20H,2-8,13H2,1H3/t16-/m0/s1 |
| InChIKey | YACVVXUTNFZAFL-INIZCTEOSA-N |
| XLogP | 4.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-bromophenyl)-2-oxoethyl] (7S)-7-hydroxydecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-bromophenyl)-2-oxoethyl] (7S)-7-hydroxydecanoate?
The IUPAC name of [2-(4-bromophenyl)-2-oxoethyl] (7S)-7-hydroxydecanoate (CID 46209633) is [2-(4-bromophenyl)-2-oxoethyl] (7S)-7-hydroxydecanoate.
What is the SMILES notation for [2-(4-bromophenyl)-2-oxoethyl] (7S)-7-hydroxydecanoate?
The canonical SMILES for [2-(4-bromophenyl)-2-oxoethyl] (7S)-7-hydroxydecanoate is CCC[C@H](O)CCCCCC(=O)OCC(=O)c1ccc(Br)cc1.
What is the InChIKey of [2-(4-bromophenyl)-2-oxoethyl] (7S)-7-hydroxydecanoate?
The InChIKey is YACVVXUTNFZAFL-INIZCTEOSA-N. The full InChI is InChI=1S/C18H25BrO4/c1-2-6-16(20)7-4-3-5-8-18(22)23-13-17(21)14-9-11-15(19)12-10-14/h9-12,16,20H,2-8,13H2,1H3/t16-/m0/s1.
What are the key properties of [2-(4-bromophenyl)-2-oxoethyl] (7S)-7-hydroxydecanoate?
[2-(4-bromophenyl)-2-oxoethyl] (7S)-7-hydroxydecanoate has a molecular weight of 385.30 g/mol, XLogP of 4.29, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-bromophenyl)-2-oxoethyl] (7S)-7-hydroxydecanoate is sourced from PubChem (CID 46209633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).