About [2-(4-bromophenyl)-2-oxoethyl] 7-cyanoheptanoate
[2-(4-bromophenyl)-2-oxoethyl] 7-cyanoheptanoate (PubChem CID 71383015) has the molecular formula C16H18BrNO3
and a molecular weight of 352.23 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 7-cyanoheptanoate.
Molecular Properties
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 7-cyanoheptanoate |
| PubChem CID | 71383015 |
| Molecular Formula | C16H18BrNO3 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 7-cyanoheptanoate |
| SMILES | N#CCCCCCCC(=O)OCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H18BrNO3/c17-14-9-7-13(8-10-14)15(19)12-21-16(20)6-4-2-1-3-5-11-18/h7-10H,1-6,12H2 |
| InChIKey | VCWUYXAAGIRVKM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-bromophenyl)-2-oxoethyl] 7-cyanoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-bromophenyl)-2-oxoethyl] 7-cyanoheptanoate?
The IUPAC name of [2-(4-bromophenyl)-2-oxoethyl] 7-cyanoheptanoate (CID 71383015) is [2-(4-bromophenyl)-2-oxoethyl] 7-cyanoheptanoate.
What is the SMILES notation for [2-(4-bromophenyl)-2-oxoethyl] 7-cyanoheptanoate?
The canonical SMILES for [2-(4-bromophenyl)-2-oxoethyl] 7-cyanoheptanoate is N#CCCCCCCC(=O)OCC(=O)c1ccc(Br)cc1.
What is the InChIKey of [2-(4-bromophenyl)-2-oxoethyl] 7-cyanoheptanoate?
The InChIKey is VCWUYXAAGIRVKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18BrNO3/c17-14-9-7-13(8-10-14)15(19)12-21-16(20)6-4-2-1-3-5-11-18/h7-10H,1-6,12H2.
What are the key properties of [2-(4-bromophenyl)-2-oxoethyl] 7-cyanoheptanoate?
[2-(4-bromophenyl)-2-oxoethyl] 7-cyanoheptanoate has a molecular weight of 352.23 g/mol, XLogP of 4.04, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-bromophenyl)-2-oxoethyl] 7-cyanoheptanoate is sourced from PubChem (CID 71383015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).