C26H35BrO4 — CID 177494658
[2-(4-bromophenyl)-2-oxoethyl] 8-[(2S,3R)-3-[(2Z,5Z)-octa-2,5-dienyl]oxiran-2-yl]octanoate (PubChem CID 177494658) has the molecular formula C26H35BrO4 and a molecular weight of 491.47 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 8-[(2S,3R)-3-[(2Z,5Z)-octa-2,5-dienyl]oxiran-2-yl]octanoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 8-[(2S,3R)-3-[(2Z,5Z)-octa-2,5-dienyl]oxiran-2-yl]octanoate |
|---|---|
| PubChem CID | 177494658 |
| Molecular Formula | C26H35BrO4 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 8-[(2S,3R)-3-[(2Z,5Z)-octa-2,5-dienyl]oxiran-2-yl]octanoate |
| SMILES | CC/C=C\C/C=C\C[C@H]1O[C@H]1CCCCCCCC(=O)OCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H35BrO4/c1-2-3-4-5-7-10-13-24-25(31-24)14-11-8-6-9-12-15-26(29)30-20-23(28)21-16-18-22(27)19-17-21/h3-4,7,10,16-19,24-25H,2,5-6,8-9,11-15,20H2,1H3/b4-3-,10-7-/t24-,25+/m1/s1 |
| InChIKey | RUESRGNEFNCRBK-FSEKKFBUSA-N |
| XLogP | 6.98 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|