2-amino-2-methoxyacetic acid

C3H7NO3 — CID 23501104

IUPAC2-amino-2-methoxyacetic acid
SMILESCOC(N)C(=O)O
InChIInChI=1S/C3H7NO3/c1-7-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)
InChIKeyXYZVTJQQUFLMJY-UHFFFAOYSA-N
MW105.09 g/mol
LogP-1.00
Rot. Bonds2

About 2-amino-2-methoxyacetic acid

2-amino-2-methoxyacetic acid (PubChem CID 23501104) has the molecular formula C3H7NO3 and a molecular weight of 105.09 g/mol. Its IUPAC name is 2-amino-2-methoxyacetic acid.

Molecular Properties

Compound Name2-amino-2-methoxyacetic acid
PubChem CID23501104
Molecular FormulaC3H7NO3
Molecular Weight105.09 g/mol
Exact Mass105.04
IUPAC Name2-amino-2-methoxyacetic acid
SMILESCOC(N)C(=O)O
InChIInChI=1S/C3H7NO3/c1-7-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)
InChIKeyXYZVTJQQUFLMJY-UHFFFAOYSA-N
XLogP-1.00
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500105.09
LogP ≤ 5-1.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-amino-2-methoxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-methoxyacetic acid?
The IUPAC name of 2-amino-2-methoxyacetic acid (CID 23501104) is 2-amino-2-methoxyacetic acid.
What is the SMILES notation for 2-amino-2-methoxyacetic acid?
The canonical SMILES for 2-amino-2-methoxyacetic acid is COC(N)C(=O)O.
What is the InChIKey of 2-amino-2-methoxyacetic acid?
The InChIKey is XYZVTJQQUFLMJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO3/c1-7-2(4)3(5)6/h2H,4H2,1H3,(H,5,6).
What are the key properties of 2-amino-2-methoxyacetic acid?
2-amino-2-methoxyacetic acid has a molecular weight of 105.09 g/mol, XLogP of -1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-methoxyacetic acid is sourced from PubChem (CID 23501104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).