About 2-amino-2-methoxyacetic acid
2-amino-2-methoxyacetic acid (PubChem CID 23501104) has the molecular formula C3H7NO3
and a molecular weight of 105.09 g/mol. Its IUPAC name is 2-amino-2-methoxyacetic acid.
Molecular Properties
| Compound Name | 2-amino-2-methoxyacetic acid |
| PubChem CID | 23501104 |
| Molecular Formula | C3H7NO3 |
| Molecular Weight | 105.09 g/mol |
| Exact Mass | 105.04 |
| IUPAC Name | 2-amino-2-methoxyacetic acid |
| SMILES | COC(N)C(=O)O |
| InChI | InChI=1S/C3H7NO3/c1-7-2(4)3(5)6/h2H,4H2,1H3,(H,5,6) |
| InChIKey | XYZVTJQQUFLMJY-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.09 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-methoxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-methoxyacetic acid?
The IUPAC name of 2-amino-2-methoxyacetic acid (CID 23501104) is 2-amino-2-methoxyacetic acid.
What is the SMILES notation for 2-amino-2-methoxyacetic acid?
The canonical SMILES for 2-amino-2-methoxyacetic acid is COC(N)C(=O)O.
What is the InChIKey of 2-amino-2-methoxyacetic acid?
The InChIKey is XYZVTJQQUFLMJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO3/c1-7-2(4)3(5)6/h2H,4H2,1H3,(H,5,6).
What are the key properties of 2-amino-2-methoxyacetic acid?
2-amino-2-methoxyacetic acid has a molecular weight of 105.09 g/mol, XLogP of -1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-methoxyacetic acid is sourced from PubChem (CID 23501104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).