C42H42NP3 — CID 23504438
N,N-bis(1,1-diphenyl-2-phosphanylethyl)-1,1-diphenyl-2-phosphanylethanamine (PubChem CID 23504438) has the molecular formula C42H42NP3 and a molecular weight of 653.73 g/mol. Its IUPAC name is N,N-bis(1,1-diphenyl-2-phosphanylethyl)-1,1-diphenyl-2-phosphanylethanamine.
| Compound Name | N,N-bis(1,1-diphenyl-2-phosphanylethyl)-1,1-diphenyl-2-phosphanylethanamine |
|---|---|
| PubChem CID | 23504438 |
| Molecular Formula | C42H42NP3 |
| Molecular Weight | 653.73 g/mol |
| Exact Mass | 653.25 |
| IUPAC Name | N,N-bis(1,1-diphenyl-2-phosphanylethyl)-1,1-diphenyl-2-phosphanylethanamine |
| SMILES | PCC(c1ccccc1)(c1ccccc1)N(C(CP)(c1ccccc1)c1ccccc1)C(CP)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H42NP3/c44-31-40(34-19-7-1-8-20-34,35-21-9-2-10-22-35)43(41(32-45,36-23-11-3-12-24-36)37-25-13-4-14-26-37)42(33-46,38-27-15-5-16-28-38)39-29-17-6-18-30-39/h1-30H,31-33,44-46H2 |
| InChIKey | KEVWXYZOLXEBAL-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.73 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|