C22H19FO5S — CID 23505534
2-[[4-(4-fluorophenyl)phenyl]sulfonylmethyl]-3-phenoxypropanoic acid (PubChem CID 23505534) has the molecular formula C22H19FO5S and a molecular weight of 414.45 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)phenyl]sulfonylmethyl]-3-phenoxypropanoic acid.
| Compound Name | 2-[[4-(4-fluorophenyl)phenyl]sulfonylmethyl]-3-phenoxypropanoic acid |
|---|---|
| PubChem CID | 23505534 |
| Molecular Formula | C22H19FO5S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)phenyl]sulfonylmethyl]-3-phenoxypropanoic acid |
| SMILES | O=C(O)C(COc1ccccc1)CS(=O)(=O)c1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H19FO5S/c23-19-10-6-16(7-11-19)17-8-12-21(13-9-17)29(26,27)15-18(22(24)25)14-28-20-4-2-1-3-5-20/h1-13,18H,14-15H2,(H,24,25) |
| InChIKey | KPEFUJZSYPSOMR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |