C5H14N2O6S — CID 23506663
2,5-diamino-1-hydroxypentan-3-one;sulfuric acid (PubChem CID 23506663) has the molecular formula C5H14N2O6S and a molecular weight of 230.24 g/mol. Its IUPAC name is 2,5-diamino-1-hydroxypentan-3-one;sulfuric acid.
| Compound Name | 2,5-diamino-1-hydroxypentan-3-one;sulfuric acid |
|---|---|
| PubChem CID | 23506663 |
| Molecular Formula | C5H14N2O6S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2,5-diamino-1-hydroxypentan-3-one;sulfuric acid |
| SMILES | NCCC(=O)C(N)CO.O=S(=O)(O)O |
| InChI | InChI=1S/C5H12N2O2.H2O4S/c6-2-1-5(9)4(7)3-8;1-5(2,3)4/h4,8H,1-3,6-7H2;(H2,1,2,3,4) |
| InChIKey | LGRLZPAYEMLQKX-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|