About [4-[(4-hydroxyanilino)methyl]phenyl] sulfamate
[4-[(4-hydroxyanilino)methyl]phenyl] sulfamate (PubChem CID 23508527) has the molecular formula C13H14N2O4S
and a molecular weight of 294.33 g/mol. Its IUPAC name is [4-[(4-hydroxyanilino)methyl]phenyl] sulfamate.
Molecular Properties
| Compound Name | [4-[(4-hydroxyanilino)methyl]phenyl] sulfamate |
| PubChem CID | 23508527 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | [4-[(4-hydroxyanilino)methyl]phenyl] sulfamate |
| SMILES | NS(=O)(=O)Oc1ccc(CNc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C13H14N2O4S/c14-20(17,18)19-13-7-1-10(2-8-13)9-15-11-3-5-12(16)6-4-11/h1-8,15-16H,9H2,(H2,14,17,18) |
| InChIKey | LZMVOWJCRGAUMD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_OH_alk_A(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze [4-[(4-hydroxyanilino)methyl]phenyl] sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-hydroxyanilino)methyl]phenyl] sulfamate?
The IUPAC name of [4-[(4-hydroxyanilino)methyl]phenyl] sulfamate (CID 23508527) is [4-[(4-hydroxyanilino)methyl]phenyl] sulfamate.
What is the SMILES notation for [4-[(4-hydroxyanilino)methyl]phenyl] sulfamate?
The canonical SMILES for [4-[(4-hydroxyanilino)methyl]phenyl] sulfamate is NS(=O)(=O)Oc1ccc(CNc2ccc(O)cc2)cc1.
What is the InChIKey of [4-[(4-hydroxyanilino)methyl]phenyl] sulfamate?
The InChIKey is LZMVOWJCRGAUMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4S/c14-20(17,18)19-13-7-1-10(2-8-13)9-15-11-3-5-12(16)6-4-11/h1-8,15-16H,9H2,(H2,14,17,18).
What are the key properties of [4-[(4-hydroxyanilino)methyl]phenyl] sulfamate?
[4-[(4-hydroxyanilino)methyl]phenyl] sulfamate has a molecular weight of 294.33 g/mol, XLogP of 1.59, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-hydroxyanilino)methyl]phenyl] sulfamate is sourced from PubChem (CID 23508527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).