C12H10ClNO4 — CID 23513553
2-(4-chloro-1H-indol-3-yl)butanedioic acid (PubChem CID 23513553) has the molecular formula C12H10ClNO4 and a molecular weight of 267.67 g/mol. Its IUPAC name is 2-(4-chloro-1H-indol-3-yl)butanedioic acid.
| Compound Name | 2-(4-chloro-1H-indol-3-yl)butanedioic acid |
|---|---|
| PubChem CID | 23513553 |
| Molecular Formula | C12H10ClNO4 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2-(4-chloro-1H-indol-3-yl)butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)c1c[nH]c2cccc(Cl)c12 |
| InChI | InChI=1S/C12H10ClNO4/c13-8-2-1-3-9-11(8)7(5-14-9)6(12(17)18)4-10(15)16/h1-3,5-6,14H,4H2,(H,15,16)(H,17,18) |
| InChIKey | VZWKOPIQQUIVII-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |