About (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol
(1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol (PubChem CID 72707576) has the molecular formula C22H18ClNO
and a molecular weight of 347.85 g/mol. Its IUPAC name is (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol.
Molecular Properties
| Compound Name | (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol |
| PubChem CID | 72707576 |
| Molecular Formula | C22H18ClNO |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol |
| SMILES | O[C@@H](c1ccccc1)[C@H](c1ccccc1)c1c[nH]c2cccc(Cl)c12 |
| InChI | InChI=1S/C22H18ClNO/c23-18-12-7-13-19-21(18)17(14-24-19)20(15-8-3-1-4-9-15)22(25)16-10-5-2-6-11-16/h1-14,20,22,24-25H/t20-,22+/m1/s1 |
| InChIKey | BWCNKORPYTXMKP-IRLDBZIGSA-N |
| XLogP | 5.69 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol?
The IUPAC name of (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol (CID 72707576) is (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol.
What is the SMILES notation for (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol?
The canonical SMILES for (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol is O[C@@H](c1ccccc1)[C@H](c1ccccc1)c1c[nH]c2cccc(Cl)c12.
What is the InChIKey of (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol?
The InChIKey is BWCNKORPYTXMKP-IRLDBZIGSA-N. The full InChI is InChI=1S/C22H18ClNO/c23-18-12-7-13-19-21(18)17(14-24-19)20(15-8-3-1-4-9-15)22(25)16-10-5-2-6-11-16/h1-14,20,22,24-25H/t20-,22+/m1/s1.
What are the key properties of (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol?
(1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol has a molecular weight of 347.85 g/mol, XLogP of 5.69, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol is sourced from PubChem (CID 72707576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).