C22H18ClNO — CID 72707576
(1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol (PubChem CID 72707576) has the molecular formula C22H18ClNO and a molecular weight of 347.85 g/mol. Its IUPAC name is (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol.
| Compound Name | (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol |
|---|---|
| PubChem CID | 72707576 |
| Molecular Formula | C22H18ClNO |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | (1R,2R)-2-(4-chloro-1H-indol-3-yl)-1,2-diphenylethanol |
| SMILES | O[C@@H](c1ccccc1)[C@H](c1ccccc1)c1c[nH]c2cccc(Cl)c12 |
| InChI | InChI=1S/C22H18ClNO/c23-18-12-7-13-19-21(18)17(14-24-19)20(15-8-3-1-4-9-15)22(25)16-10-5-2-6-11-16/h1-14,20,22,24-25H/t20-,22+/m1/s1 |
| InChIKey | BWCNKORPYTXMKP-IRLDBZIGSA-N |
| XLogP | 5.69 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |