C18H20O8 — CID 23514208
1,4-bis(1-prop-2-enoyloxyethyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid (PubChem CID 23514208) has the molecular formula C18H20O8 and a molecular weight of 364.35 g/mol. Its IUPAC name is 1,4-bis(1-prop-2-enoyloxyethyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid.
| Compound Name | 1,4-bis(1-prop-2-enoyloxyethyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 23514208 |
| Molecular Formula | C18H20O8 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1,4-bis(1-prop-2-enoyloxyethyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid |
| SMILES | C=CC(=O)OC(C)C1(C(=O)O)C=CC(C(=O)O)(C(C)OC(=O)C=C)C=C1 |
| InChI | InChI=1S/C18H20O8/c1-5-13(19)25-11(3)17(15(21)22)7-9-18(10-8-17,16(23)24)12(4)26-14(20)6-2/h5-12H,1-2H2,3-4H3,(H,21,22)(H,23,24) |
| InChIKey | GJUTWLXYRDPQEW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|