C17H16N4O3 — CID 23514653
1-[[6-[(2E)-2-benzylidenehydrazinyl]-3-pyridinyl]methoxy]pyrrolidine-2,5-dione (PubChem CID 23514653) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-[[6-[(2E)-2-benzylidenehydrazinyl]-3-pyridinyl]methoxy]pyrrolidine-2,5-dione.
| Compound Name | 1-[[6-[(2E)-2-benzylidenehydrazinyl]-3-pyridinyl]methoxy]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 23514653 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-[[6-[(2E)-2-benzylidenehydrazinyl]-3-pyridinyl]methoxy]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1OCc1ccc(N/N=C/c2ccccc2)nc1 |
| InChI | InChI=1S/C17H16N4O3/c22-16-8-9-17(23)21(16)24-12-14-6-7-15(18-10-14)20-19-11-13-4-2-1-3-5-13/h1-7,10-11H,8-9,12H2,(H,18,20)/b19-11+ |
| InChIKey | VLECDTLKDCHDTO-YBFXNURJSA-N |
| XLogP | 2.11 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|