C53H50N6O5S2 — CID 23516610
1,3-bis[2-[2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]ethoxy]ethylsulfanyl]propan-2-ol (PubChem CID 23516610) has the molecular formula C53H50N6O5S2 and a molecular weight of 915.15 g/mol. Its IUPAC name is 1,3-bis[2-[2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]ethoxy]ethylsulfanyl]propan-2-ol.
| Compound Name | 1,3-bis[2-[2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]ethoxy]ethylsulfanyl]propan-2-ol |
|---|---|
| PubChem CID | 23516610 |
| Molecular Formula | C53H50N6O5S2 |
| Molecular Weight | 915.15 g/mol |
| Exact Mass | 914.33 |
| IUPAC Name | 1,3-bis[2-[2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]ethoxy]ethylsulfanyl]propan-2-ol |
| SMILES | OC(CSCCOCCOc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1)CSCCOCCOc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C53H50N6O5S2/c60-43(37-65-31-29-61-25-27-63-44-17-13-39(14-18-44)41-33-50(46-9-1-5-21-54-46)58-51(34-41)47-10-2-6-22-55-47)38-66-32-30-62-26-28-64-45-19-15-40(16-20-45)42-35-52(48-11-3-7-23-56-48)59-53(36-42)49-12-4-8-24-57-49/h1-24,33-36,43,60H,25-32,37-38H2 |
| InChIKey | PCHXDQDGDUDQIJ-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.15 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|