C14H20O7 — CID 23518049
3-(5,6-dihydroxyhexoxycarbonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 23518049) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is 3-(5,6-dihydroxyhexoxycarbonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-(5,6-dihydroxyhexoxycarbonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 23518049 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 3-(5,6-dihydroxyhexoxycarbonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)C1C2C=CC(O2)C1C(=O)OCCCCC(O)CO |
| InChI | InChI=1S/C14H20O7/c15-7-8(16)3-1-2-6-20-14(19)12-10-5-4-9(21-10)11(12)13(17)18/h4-5,8-12,15-16H,1-3,6-7H2,(H,17,18) |
| InChIKey | ZZOMOBQSTIWXPB-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|