C16H29N3O5 — CID 23520227
(2S)-1-[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-propylpyrrolidine-2-carboxamide (PubChem CID 23520227) has the molecular formula C16H29N3O5 and a molecular weight of 343.42 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-propylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-propylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23520227 |
| Molecular Formula | C16H29N3O5 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (2S)-1-[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-N-propylpyrrolidine-2-carboxamide |
| SMILES | CCCC[C@@H](C(=O)N1CCC[C@H]1C(=O)NCCC)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C16H29N3O5/c1-3-5-7-11(13(20)15(22)18-24)16(23)19-10-6-8-12(19)14(21)17-9-4-2/h11-13,20,24H,3-10H2,1-2H3,(H,17,21)(H,18,22)/t11-,12+,13+/m1/s1 |
| InChIKey | GGDRMLIFDZMARF-AGIUHOORSA-N |
| XLogP | 0.18 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|