C30H47N3O7S2 — CID 23521754
7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-pyrrolidin-1-ylsulfonyl-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 23521754) has the molecular formula C30H47N3O7S2 and a molecular weight of 625.85 g/mol. Its IUPAC name is 7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-pyrrolidin-1-ylsulfonyl-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-pyrrolidin-1-ylsulfonyl-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 23521754 |
| Molecular Formula | C30H47N3O7S2 |
| Molecular Weight | 625.85 g/mol |
| Exact Mass | 625.29 |
| IUPAC Name | 7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-17-pyrrolidin-1-ylsulfonyl-4-oxa-17-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C/C(=C\c1csc(C)n1)C1CC2C(CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O1)N2S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C30H47N3O7S2/c1-18-10-9-11-23-24(33(23)42(38,39)32-12-7-8-13-32)15-25(19(2)14-22-17-41-21(4)31-22)40-27(35)16-26(34)30(5,6)29(37)20(3)28(18)36/h14,17-18,20,23-26,28,34,36H,7-13,15-16H2,1-6H3/b19-14+ |
| InChIKey | GAPIKIYTLLGCQR-XMHGGMMESA-N |
| XLogP | 3.71 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.85 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|