C15H16F2N3O2+ — CID 23524739
2,2-difluoro-N'-[2-[(1-methylpyridin-1-ium-3-yl)methoxy]phenyl]acetohydrazide (PubChem CID 23524739) has the molecular formula C15H16F2N3O2+ and a molecular weight of 308.31 g/mol. Its IUPAC name is 2,2-difluoro-N'-[2-[(1-methylpyridin-1-ium-3-yl)methoxy]phenyl]acetohydrazide.
| Compound Name | 2,2-difluoro-N'-[2-[(1-methylpyridin-1-ium-3-yl)methoxy]phenyl]acetohydrazide |
|---|---|
| PubChem CID | 23524739 |
| Molecular Formula | C15H16F2N3O2+ |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2,2-difluoro-N'-[2-[(1-methylpyridin-1-ium-3-yl)methoxy]phenyl]acetohydrazide |
| SMILES | C[n+]1cccc(COc2ccccc2NNC(=O)C(F)F)c1 |
| InChI | InChI=1S/C15H15F2N3O2/c1-20-8-4-5-11(9-20)10-22-13-7-3-2-6-12(13)18-19-15(21)14(16)17/h2-9,14,18H,10H2,1H3/p+1 |
| InChIKey | ZDMBNPQLYCHKFH-UHFFFAOYSA-O |
| XLogP | 1.80 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|