1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid

C8H10NO3+ — CID 23525899

IUPAC1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid
SMILESCc1cc[n+](O)c(C)c1C(=O)O
InChIInChI=1S/C8H9NO3/c1-5-3-4-9(12)6(2)7(5)8(10)11/h3-4H,1-2H3,(H-,10,11,12)/p+1
InChIKeyRQZYZGFPKGULPZ-UHFFFAOYSA-O
MW168.17 g/mol
LogP0.53
Rot. Bonds1

About 1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid

1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid (PubChem CID 23525899) has the molecular formula C8H10NO3+ and a molecular weight of 168.17 g/mol. Its IUPAC name is 1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid.

Molecular Properties

Compound Name1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid
PubChem CID23525899
Molecular FormulaC8H10NO3+
Molecular Weight168.17 g/mol
Exact Mass168.07
IUPAC Name1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid
SMILESCc1cc[n+](O)c(C)c1C(=O)O
InChIInChI=1S/C8H9NO3/c1-5-3-4-9(12)6(2)7(5)8(10)11/h3-4H,1-2H3,(H-,10,11,12)/p+1
InChIKeyRQZYZGFPKGULPZ-UHFFFAOYSA-O
XLogP0.53
TPSA61.41 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.17
LogP ≤ 50.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid?
The IUPAC name of 1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid (CID 23525899) is 1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid.
What is the SMILES notation for 1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid?
The canonical SMILES for 1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid is Cc1cc[n+](O)c(C)c1C(=O)O.
What is the InChIKey of 1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid?
The InChIKey is RQZYZGFPKGULPZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H9NO3/c1-5-3-4-9(12)6(2)7(5)8(10)11/h3-4H,1-2H3,(H-,10,11,12)/p+1.
What are the key properties of 1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid?
1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid has a molecular weight of 168.17 g/mol, XLogP of 0.53, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2,4-dimethylpyridin-1-ium-3-carboxylic acid is sourced from PubChem (CID 23525899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).