C6H14N4O2 — CID 23526196
1-hydroxy-3-(4-methylpiperazin-1-yl)urea (PubChem CID 23526196) has the molecular formula C6H14N4O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 1-hydroxy-3-(4-methylpiperazin-1-yl)urea.
| Compound Name | 1-hydroxy-3-(4-methylpiperazin-1-yl)urea |
|---|---|
| PubChem CID | 23526196 |
| Molecular Formula | C6H14N4O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | 1-hydroxy-3-(4-methylpiperazin-1-yl)urea |
| SMILES | CN1CCN(NC(=O)NO)CC1 |
| InChI | InChI=1S/C6H14N4O2/c1-9-2-4-10(5-3-9)7-6(11)8-12/h12H,2-5H2,1H3,(H2,7,8,11) |
| InChIKey | DSOMVCXUNYTVNJ-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|