C14H26N4O3 — CID 83017667
1-[(4-methylpiperazin-1-yl)carbamoylamino]cycloheptane-1-carboxylic acid (PubChem CID 83017667) has the molecular formula C14H26N4O3 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-[(4-methylpiperazin-1-yl)carbamoylamino]cycloheptane-1-carboxylic acid.
| Compound Name | 1-[(4-methylpiperazin-1-yl)carbamoylamino]cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 83017667 |
| Molecular Formula | C14H26N4O3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 1-[(4-methylpiperazin-1-yl)carbamoylamino]cycloheptane-1-carboxylic acid |
| SMILES | CN1CCN(NC(=O)NC2(C(=O)O)CCCCCC2)CC1 |
| InChI | InChI=1S/C14H26N4O3/c1-17-8-10-18(11-9-17)16-13(21)15-14(12(19)20)6-4-2-3-5-7-14/h2-11H2,1H3,(H,19,20)(H2,15,16,21) |
| InChIKey | RHDBNJYAINRFMR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |