C11H22N4O3 — CID 83019684
5-[(4-methylpiperazin-1-yl)carbamoylamino]pentanoic acid (PubChem CID 83019684) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 5-[(4-methylpiperazin-1-yl)carbamoylamino]pentanoic acid.
| Compound Name | 5-[(4-methylpiperazin-1-yl)carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 83019684 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 5-[(4-methylpiperazin-1-yl)carbamoylamino]pentanoic acid |
| SMILES | CN1CCN(NC(=O)NCCCCC(=O)O)CC1 |
| InChI | InChI=1S/C11H22N4O3/c1-14-6-8-15(9-7-14)13-11(18)12-5-3-2-4-10(16)17/h2-9H2,1H3,(H,16,17)(H2,12,13,18) |
| InChIKey | FBMRJZSYJVBYHP-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|