C72H82N2 — CID 23526245
1-N,4-N-bis(2,6-dibutyl-4-methylphenyl)-2,3-dimethyl-1-N,4-N-bis[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]naphthalene-1,4-diamine (PubChem CID 23526245) has the molecular formula C72H82N2 and a molecular weight of 975.46 g/mol. Its IUPAC name is 1-N,4-N-bis(2,6-dibutyl-4-methylphenyl)-2,3-dimethyl-1-N,4-N-bis[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]naphthalene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(2,6-dibutyl-4-methylphenyl)-2,3-dimethyl-1-N,4-N-bis[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]naphthalene-1,4-diamine |
|---|---|
| PubChem CID | 23526245 |
| Molecular Formula | C72H82N2 |
| Molecular Weight | 975.46 g/mol |
| Exact Mass | 974.65 |
| IUPAC Name | 1-N,4-N-bis(2,6-dibutyl-4-methylphenyl)-2,3-dimethyl-1-N,4-N-bis[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]naphthalene-1,4-diamine |
| SMILES | CCCCc1cc(C)cc(CCCC)c1N(c1ccc(/C=C/c2ccc(C)cc2)cc1)c1c(C)c(C)c(N(c2ccc(/C=C/c3ccc(C)cc3)cc2)c2c(CCCC)cc(C)cc2CCCC)c2ccccc12 |
| InChI | InChI=1S/C72H82N2/c1-11-15-21-61-47-53(7)48-62(22-16-12-2)71(61)73(65-43-39-59(40-44-65)37-35-57-31-27-51(5)28-32-57)69-55(9)56(10)70(68-26-20-19-25-67(68)69)74(72-63(23-17-13-3)49-54(8)50-64(72)24-18-14-4)66-45-41-60(42-46-66)38-36-58-33-29-52(6)30-34-58/h19-20,25-50H,11-18,21-24H2,1-10H3/b37-35+,38-36+ |
| InChIKey | XNCUBEGUFRLPDQ-ATXIYDNESA-N |
| XLogP | 21.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.46 |
| LogP ≤ 5 | 21.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|