C16H34O5Si — CID 23527398
3-[hydroxy(dimethyl)silyl]propyl 4-ethoxy-2-methyl-5-propoxypentanoate (PubChem CID 23527398) has the molecular formula C16H34O5Si and a molecular weight of 334.53 g/mol. Its IUPAC name is 3-[hydroxy(dimethyl)silyl]propyl 4-ethoxy-2-methyl-5-propoxypentanoate.
| Compound Name | 3-[hydroxy(dimethyl)silyl]propyl 4-ethoxy-2-methyl-5-propoxypentanoate |
|---|---|
| PubChem CID | 23527398 |
| Molecular Formula | C16H34O5Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 3-[hydroxy(dimethyl)silyl]propyl 4-ethoxy-2-methyl-5-propoxypentanoate |
| SMILES | CCCOCC(CC(C)C(=O)OCCC[Si](C)(C)O)OCC |
| InChI | InChI=1S/C16H34O5Si/c1-6-9-19-13-15(20-7-2)12-14(3)16(17)21-10-8-11-22(4,5)18/h14-15,18H,6-13H2,1-5H3 |
| InChIKey | PUKYUUOYMDVLPZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|