About 3-trimethylsilylpropyl 4-ethoxy-2-methyl-5-propoxypentanoate
3-trimethylsilylpropyl 4-ethoxy-2-methyl-5-propoxypentanoate (PubChem CID 23527399) has the molecular formula C17H36O4Si
and a molecular weight of 332.56 g/mol. Its IUPAC name is 3-trimethylsilylpropyl 4-ethoxy-2-methyl-5-propoxypentanoate.
Molecular Properties
| Compound Name | 3-trimethylsilylpropyl 4-ethoxy-2-methyl-5-propoxypentanoate |
| PubChem CID | 23527399 |
| Molecular Formula | C17H36O4Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 3-trimethylsilylpropyl 4-ethoxy-2-methyl-5-propoxypentanoate |
| SMILES | CCCOCC(CC(C)C(=O)OCCC[Si](C)(C)C)OCC |
| InChI | InChI=1S/C17H36O4Si/c1-7-10-19-14-16(20-8-2)13-15(3)17(18)21-11-9-12-22(4,5)6/h15-16H,7-14H2,1-6H3 |
| InChIKey | OOAXRTABJHBAQF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-trimethylsilylpropyl 4-ethoxy-2-methyl-5-propoxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trimethylsilylpropyl 4-ethoxy-2-methyl-5-propoxypentanoate?
The IUPAC name of 3-trimethylsilylpropyl 4-ethoxy-2-methyl-5-propoxypentanoate (CID 23527399) is 3-trimethylsilylpropyl 4-ethoxy-2-methyl-5-propoxypentanoate.
What is the SMILES notation for 3-trimethylsilylpropyl 4-ethoxy-2-methyl-5-propoxypentanoate?
The canonical SMILES for 3-trimethylsilylpropyl 4-ethoxy-2-methyl-5-propoxypentanoate is CCCOCC(CC(C)C(=O)OCCC[Si](C)(C)C)OCC.
What is the InChIKey of 3-trimethylsilylpropyl 4-ethoxy-2-methyl-5-propoxypentanoate?
The InChIKey is OOAXRTABJHBAQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O4Si/c1-7-10-19-14-16(20-8-2)13-15(3)17(18)21-11-9-12-22(4,5)6/h15-16H,7-14H2,1-6H3.
What are the key properties of 3-trimethylsilylpropyl 4-ethoxy-2-methyl-5-propoxypentanoate?
3-trimethylsilylpropyl 4-ethoxy-2-methyl-5-propoxypentanoate has a molecular weight of 332.56 g/mol, XLogP of 4.12, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trimethylsilylpropyl 4-ethoxy-2-methyl-5-propoxypentanoate is sourced from PubChem (CID 23527399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).