C32H66O9Si2 — CID 23527397
3-[[3-(4-ethoxy-2-methyl-5-propoxypentanoyl)oxypropyl-dimethylsilyl]oxy-dimethylsilyl]propyl 4-ethoxy-2-methyl-5-propoxypentanoate (PubChem CID 23527397) has the molecular formula C32H66O9Si2 and a molecular weight of 651.04 g/mol. Its IUPAC name is 3-[[3-(4-ethoxy-2-methyl-5-propoxypentanoyl)oxypropyl-dimethylsilyl]oxy-dimethylsilyl]propyl 4-ethoxy-2-methyl-5-propoxypentanoate.
| Compound Name | 3-[[3-(4-ethoxy-2-methyl-5-propoxypentanoyl)oxypropyl-dimethylsilyl]oxy-dimethylsilyl]propyl 4-ethoxy-2-methyl-5-propoxypentanoate |
|---|---|
| PubChem CID | 23527397 |
| Molecular Formula | C32H66O9Si2 |
| Molecular Weight | 651.04 g/mol |
| Exact Mass | 650.42 |
| IUPAC Name | 3-[[3-(4-ethoxy-2-methyl-5-propoxypentanoyl)oxypropyl-dimethylsilyl]oxy-dimethylsilyl]propyl 4-ethoxy-2-methyl-5-propoxypentanoate |
| SMILES | CCCOCC(CC(C)C(=O)OCCC[Si](C)(C)O[Si](C)(C)CCCOC(=O)C(C)CC(COCCC)OCC)OCC |
| InChI | InChI=1S/C32H66O9Si2/c1-11-17-35-25-29(37-13-3)23-27(5)31(33)39-19-15-21-42(7,8)41-43(9,10)22-16-20-40-32(34)28(6)24-30(38-14-4)26-36-18-12-2/h27-30H,11-26H2,1-10H3 |
| InChIKey | KIMRCIPSFBIYLR-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.04 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|