C20H44O4Si2 — CID 156726782
ethyl 5-[tert-butyl-[[tert-butyl(dimethyl)silyl]oxymethyl]-methylsilyl]oxy-4-methylpentanoate (PubChem CID 156726782) has the molecular formula C20H44O4Si2 and a molecular weight of 404.74 g/mol. Its IUPAC name is ethyl 5-[tert-butyl-[[tert-butyl(dimethyl)silyl]oxymethyl]-methylsilyl]oxy-4-methylpentanoate.
| Compound Name | ethyl 5-[tert-butyl-[[tert-butyl(dimethyl)silyl]oxymethyl]-methylsilyl]oxy-4-methylpentanoate |
|---|---|
| PubChem CID | 156726782 |
| Molecular Formula | C20H44O4Si2 |
| Molecular Weight | 404.74 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | ethyl 5-[tert-butyl-[[tert-butyl(dimethyl)silyl]oxymethyl]-methylsilyl]oxy-4-methylpentanoate |
| SMILES | CCOC(=O)CCC(C)CO[Si](C)(CO[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H44O4Si2/c1-12-22-18(21)14-13-17(2)15-23-26(11,20(6,7)8)16-24-25(9,10)19(3,4)5/h17H,12-16H2,1-11H3 |
| InChIKey | HXTYLOZVDCTVDF-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.74 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|