C41H48N2O6 — CID 23527516
5-(6-ethenoxyhexoxy)-2-[[7-[[5-(6-ethenoxyhexoxy)-2-pyridinyl]methyl]-9H-fluoren-2-yl]oxymethoxy]pyridine (PubChem CID 23527516) has the molecular formula C41H48N2O6 and a molecular weight of 664.84 g/mol. Its IUPAC name is 5-(6-ethenoxyhexoxy)-2-[[7-[[5-(6-ethenoxyhexoxy)-2-pyridinyl]methyl]-9H-fluoren-2-yl]oxymethoxy]pyridine.
| Compound Name | 5-(6-ethenoxyhexoxy)-2-[[7-[[5-(6-ethenoxyhexoxy)-2-pyridinyl]methyl]-9H-fluoren-2-yl]oxymethoxy]pyridine |
|---|---|
| PubChem CID | 23527516 |
| Molecular Formula | C41H48N2O6 |
| Molecular Weight | 664.84 g/mol |
| Exact Mass | 664.35 |
| IUPAC Name | 5-(6-ethenoxyhexoxy)-2-[[7-[[5-(6-ethenoxyhexoxy)-2-pyridinyl]methyl]-9H-fluoren-2-yl]oxymethoxy]pyridine |
| SMILES | C=COCCCCCCOc1ccc(Cc2ccc3c(c2)Cc2cc(OCOc4ccc(OCCCCCCOC=C)cn4)ccc2-3)nc1 |
| InChI | InChI=1S/C41H48N2O6/c1-3-44-21-9-5-7-11-23-46-37-15-14-35(42-29-37)26-32-13-18-39-33(25-32)27-34-28-36(16-19-40(34)39)48-31-49-41-20-17-38(30-43-41)47-24-12-8-6-10-22-45-4-2/h3-4,13-20,25,28-30H,1-2,5-12,21-24,26-27,31H2 |
| InChIKey | CQHLNWKCMAUYRH-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.84 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|