C44H50N2O8 — CID 23527536
6-[[6-[[9-methyl-7-[[5-(6-prop-2-enoyloxyhexoxy)-2-pyridinyl]oxymethoxy]-9H-fluoren-2-yl]methyl]-3-pyridinyl]oxy]hexyl prop-2-enoate (PubChem CID 23527536) has the molecular formula C44H50N2O8 and a molecular weight of 734.89 g/mol. Its IUPAC name is 6-[[6-[[9-methyl-7-[[5-(6-prop-2-enoyloxyhexoxy)-2-pyridinyl]oxymethoxy]-9H-fluoren-2-yl]methyl]-3-pyridinyl]oxy]hexyl prop-2-enoate.
| Compound Name | 6-[[6-[[9-methyl-7-[[5-(6-prop-2-enoyloxyhexoxy)-2-pyridinyl]oxymethoxy]-9H-fluoren-2-yl]methyl]-3-pyridinyl]oxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 23527536 |
| Molecular Formula | C44H50N2O8 |
| Molecular Weight | 734.89 g/mol |
| Exact Mass | 734.36 |
| IUPAC Name | 6-[[6-[[9-methyl-7-[[5-(6-prop-2-enoyloxyhexoxy)-2-pyridinyl]oxymethoxy]-9H-fluoren-2-yl]methyl]-3-pyridinyl]oxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(Cc2ccc3c(c2)C(C)c2cc(OCOc4ccc(OCCCCCCOC(=O)C=C)cn4)ccc2-3)nc1 |
| InChI | InChI=1S/C44H50N2O8/c1-4-43(47)51-24-12-8-6-10-22-49-36-16-15-34(45-29-36)26-33-14-19-38-39-20-17-35(28-41(39)32(3)40(38)27-33)53-31-54-42-21-18-37(30-46-42)50-23-11-7-9-13-25-52-44(48)5-2/h4-5,14-21,27-30,32H,1-2,6-13,22-26,31H2,3H3 |
| InChIKey | LFVSJKNKYKBJEG-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 115.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.89 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|