C39H40O8 — CID 23527547
[7-[[4-(1-ethenoxybutoxy)phenoxy]methoxy]-9H-fluoren-2-yl] 4-(4-ethenoxybutoxy)benzoate (PubChem CID 23527547) has the molecular formula C39H40O8 and a molecular weight of 636.74 g/mol. Its IUPAC name is [7-[[4-(1-ethenoxybutoxy)phenoxy]methoxy]-9H-fluoren-2-yl] 4-(4-ethenoxybutoxy)benzoate.
| Compound Name | [7-[[4-(1-ethenoxybutoxy)phenoxy]methoxy]-9H-fluoren-2-yl] 4-(4-ethenoxybutoxy)benzoate |
|---|---|
| PubChem CID | 23527547 |
| Molecular Formula | C39H40O8 |
| Molecular Weight | 636.74 g/mol |
| Exact Mass | 636.27 |
| IUPAC Name | [7-[[4-(1-ethenoxybutoxy)phenoxy]methoxy]-9H-fluoren-2-yl] 4-(4-ethenoxybutoxy)benzoate |
| SMILES | C=COCCCCOc1ccc(C(=O)Oc2ccc3c(c2)Cc2cc(OCOc4ccc(OC(CCC)OC=C)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C39H40O8/c1-4-9-38(42-6-3)46-33-16-14-32(15-17-33)44-27-45-34-18-20-36-29(25-34)24-30-26-35(19-21-37(30)36)47-39(40)28-10-12-31(13-11-28)43-23-8-7-22-41-5-2/h5-6,10-21,25-26,38H,2-4,7-9,22-24,27H2,1H3 |
| InChIKey | QEHCYOAHQLODPB-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.74 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|