C34H26N4 — CID 23527768
4-[(4,6-diphenyl-1,3,5-triazin-2-yl)methyl]-N,N-diphenylaniline (PubChem CID 23527768) has the molecular formula C34H26N4 and a molecular weight of 490.61 g/mol. Its IUPAC name is 4-[(4,6-diphenyl-1,3,5-triazin-2-yl)methyl]-N,N-diphenylaniline.
| Compound Name | 4-[(4,6-diphenyl-1,3,5-triazin-2-yl)methyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 23527768 |
| Molecular Formula | C34H26N4 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 4-[(4,6-diphenyl-1,3,5-triazin-2-yl)methyl]-N,N-diphenylaniline |
| SMILES | c1ccc(-c2nc(Cc3ccc(N(c4ccccc4)c4ccccc4)cc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C34H26N4/c1-5-13-27(14-6-1)33-35-32(36-34(37-33)28-15-7-2-8-16-28)25-26-21-23-31(24-22-26)38(29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-24H,25H2 |
| InChIKey | JFXYLCMBHIETHI-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |