C16H9F7IrNO2- — CID 23527819
2-(4-fluorobenzene-6-id-1-yl)pyridine;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium (PubChem CID 23527819) has the molecular formula C16H9F7IrNO2- and a molecular weight of 572.46 g/mol. Its IUPAC name is 2-(4-fluorobenzene-6-id-1-yl)pyridine;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 2-(4-fluorobenzene-6-id-1-yl)pyridine;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 23527819 |
| Molecular Formula | C16H9F7IrNO2- |
| Molecular Weight | 572.46 g/mol |
| Exact Mass | 573.02 |
| IUPAC Name | 2-(4-fluorobenzene-6-id-1-yl)pyridine;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium |
| SMILES | Fc1c[c-]c(-c2ccccn2)cc1.O=C(/C=C(\O)C(F)(F)F)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C11H7FN.C5H2F6O2.Ir/c12-10-6-4-9(5-7-10)11-3-1-2-8-13-11;6-4(7,8)2(12)1-3(13)5(9,10)11;/h1-4,6-8H;1,12H;/q-1;;/b;2-1-; |
| InChIKey | ZXEAMPGPFYLWPU-FJOGWHKWSA-N |
| XLogP | 4.81 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|