C29H30F3N3O3 — CID 23530874
(3R,4R)-4-[(3R)-3-(6-methoxyquinolin-4-yl)-3-(methylamino)propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-3-carboxylic acid (PubChem CID 23530874) has the molecular formula C29H30F3N3O3 and a molecular weight of 525.57 g/mol. Its IUPAC name is (3R,4R)-4-[(3R)-3-(6-methoxyquinolin-4-yl)-3-(methylamino)propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[(3R)-3-(6-methoxyquinolin-4-yl)-3-(methylamino)propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 23530874 |
| Molecular Formula | C29H30F3N3O3 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | (3R,4R)-4-[(3R)-3-(6-methoxyquinolin-4-yl)-3-(methylamino)propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-3-carboxylic acid |
| SMILES | CN[C@H](CC[C@@H]1CCN(CC#Cc2cc(F)cc(F)c2F)C[C@@H]1C(=O)O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C29H30F3N3O3/c1-33-26(22-9-11-34-27-8-6-21(38-2)16-23(22)27)7-5-18-10-13-35(17-24(18)29(36)37)12-3-4-19-14-20(30)15-25(31)28(19)32/h6,8-9,11,14-16,18,24,26,33H,5,7,10,12-13,17H2,1-2H3,(H,36,37)/t18-,24+,26-/m1/s1 |
| InChIKey | QINYMRHSRORVCI-VLGQDORFSA-N |
| XLogP | 4.78 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|