C28H29F2N3O4S — CID 23530856
(3R,4R)-1-[3-(3,5-difluorophenyl)sulfanylprop-2-ynyl]-4-[(3R)-3-(hydroxyamino)-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid (PubChem CID 23530856) has the molecular formula C28H29F2N3O4S and a molecular weight of 541.62 g/mol. Its IUPAC name is (3R,4R)-1-[3-(3,5-difluorophenyl)sulfanylprop-2-ynyl]-4-[(3R)-3-(hydroxyamino)-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-1-[3-(3,5-difluorophenyl)sulfanylprop-2-ynyl]-4-[(3R)-3-(hydroxyamino)-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 23530856 |
| Molecular Formula | C28H29F2N3O4S |
| Molecular Weight | 541.62 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | (3R,4R)-1-[3-(3,5-difluorophenyl)sulfanylprop-2-ynyl]-4-[(3R)-3-(hydroxyamino)-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc([C@@H](CC[C@@H]3CCN(CC#CSc4cc(F)cc(F)c4)C[C@@H]3C(=O)O)NO)c2c1 |
| InChI | InChI=1S/C28H29F2N3O4S/c1-37-21-4-6-26-24(16-21)23(7-9-31-26)27(32-36)5-3-18-8-11-33(17-25(18)28(34)35)10-2-12-38-22-14-19(29)13-20(30)15-22/h4,6-7,9,13-16,18,25,27,32,36H,3,5,8,10-11,17H2,1H3,(H,34,35)/t18-,25+,27-/m1/s1 |
| InChIKey | FCUSBXZYCHSETL-BOVDGQEDSA-N |
| XLogP | 5.10 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|