C7H14NP — CID 23532217
3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ylphosphane (PubChem CID 23532217) has the molecular formula C7H14NP and a molecular weight of 143.17 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ylphosphane.
| Compound Name | 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ylphosphane |
|---|---|
| PubChem CID | 23532217 |
| Molecular Formula | C7H14NP |
| Molecular Weight | 143.17 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ylphosphane |
| SMILES | PN1CCC2CCCC21 |
| InChI | InChI=1S/C7H14NP/c9-8-5-4-6-2-1-3-7(6)8/h6-7H,1-5,9H2 |
| InChIKey | OISAOBPBRBSFHI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.17 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|