C13H14O5 — CID 23534373
5-(2,6-dimethylpyran-4-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 23534373) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is 5-(2,6-dimethylpyran-4-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-(2,6-dimethylpyran-4-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 23534373 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 5-(2,6-dimethylpyran-4-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1=CC(=C2C(=O)OC(C)(C)OC2=O)C=C(C)O1 |
| InChI | InChI=1S/C13H14O5/c1-7-5-9(6-8(2)16-7)10-11(14)17-13(3,4)18-12(10)15/h5-6H,1-4H3 |
| InChIKey | VXXNWFIRMUDYQE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|