C13H11O4Y- — CID 134832258
2,2-dimethyl-5-(phenylmethylidene)-1,3-dioxane-4,6-dione;yttrium (PubChem CID 134832258) has the molecular formula C13H11O4Y- and a molecular weight of 320.13 g/mol. Its IUPAC name is 2,2-dimethyl-5-(phenylmethylidene)-1,3-dioxane-4,6-dione;yttrium.
| Compound Name | 2,2-dimethyl-5-(phenylmethylidene)-1,3-dioxane-4,6-dione;yttrium |
|---|---|
| PubChem CID | 134832258 |
| Molecular Formula | C13H11O4Y- |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 2,2-dimethyl-5-(phenylmethylidene)-1,3-dioxane-4,6-dione;yttrium |
| SMILES | CC1(C)OC(=O)C(=Cc2cc[c-]cc2)C(=O)O1.[Y] |
| InChI | InChI=1S/C13H11O4.Y/c1-13(2)16-11(14)10(12(15)17-13)8-9-6-4-3-5-7-9;/h4-8H,1-2H3;/q-1; |
| InChIKey | KNKSHICDWBNATC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|